C10H13Cl2NO5S2 — CID 63191807
2,3-dichloro-4-(3-methylsulfonylpropoxy)benzenesulfonamide (PubChem CID 63191807) has the molecular formula C10H13Cl2NO5S2 and a molecular weight of 362.26 g/mol. Its IUPAC name is 2,3-dichloro-4-(3-methylsulfonylpropoxy)benzenesulfonamide.
| Compound Name | 2,3-dichloro-4-(3-methylsulfonylpropoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 63191807 |
| Molecular Formula | C10H13Cl2NO5S2 |
| Molecular Weight | 362.26 g/mol |
| Exact Mass | 360.96 |
| IUPAC Name | 2,3-dichloro-4-(3-methylsulfonylpropoxy)benzenesulfonamide |
| SMILES | CS(=O)(=O)CCCOc1ccc(S(N)(=O)=O)c(Cl)c1Cl |
| InChI | InChI=1S/C10H13Cl2NO5S2/c1-19(14,15)6-2-5-18-7-3-4-8(20(13,16)17)10(12)9(7)11/h3-4H,2,5-6H2,1H3,(H2,13,16,17) |
| InChIKey | PXDHPDACALDNJL-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 103.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.26 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|