C10H9Cl2NO3S — CID 82912289
4-but-2-ynoxy-2,3-dichlorobenzenesulfonamide (PubChem CID 82912289) has the molecular formula C10H9Cl2NO3S and a molecular weight of 294.16 g/mol. Its IUPAC name is 4-but-2-ynoxy-2,3-dichlorobenzenesulfonamide.
| Compound Name | 4-but-2-ynoxy-2,3-dichlorobenzenesulfonamide |
|---|---|
| PubChem CID | 82912289 |
| Molecular Formula | C10H9Cl2NO3S |
| Molecular Weight | 294.16 g/mol |
| Exact Mass | 292.97 |
| IUPAC Name | 4-but-2-ynoxy-2,3-dichlorobenzenesulfonamide |
| SMILES | CC#CCOc1ccc(S(N)(=O)=O)c(Cl)c1Cl |
| InChI | InChI=1S/C10H9Cl2NO3S/c1-2-3-6-16-7-4-5-8(17(13,14)15)10(12)9(7)11/h4-5H,6H2,1H3,(H2,13,14,15) |
| InChIKey | GRKDUMUERQGDQU-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.16 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|