C12H14Cl2N2O3S — CID 82913408
2,3-dichloro-4-(3-cyano-3-methylbutoxy)benzenesulfonamide (PubChem CID 82913408) has the molecular formula C12H14Cl2N2O3S and a molecular weight of 337.23 g/mol. Its IUPAC name is 2,3-dichloro-4-(3-cyano-3-methylbutoxy)benzenesulfonamide.
| Compound Name | 2,3-dichloro-4-(3-cyano-3-methylbutoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 82913408 |
| Molecular Formula | C12H14Cl2N2O3S |
| Molecular Weight | 337.23 g/mol |
| Exact Mass | 336.01 |
| IUPAC Name | 2,3-dichloro-4-(3-cyano-3-methylbutoxy)benzenesulfonamide |
| SMILES | CC(C)(C#N)CCOc1ccc(S(N)(=O)=O)c(Cl)c1Cl |
| InChI | InChI=1S/C12H14Cl2N2O3S/c1-12(2,7-15)5-6-19-8-3-4-9(20(16,17)18)11(14)10(8)13/h3-4H,5-6H2,1-2H3,(H2,16,17,18) |
| InChIKey | QJUGSAMSZNLFRN-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 93.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.23 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |