C11H15Cl2NO5S2 — CID 65098440
2,3-dichloro-4-(3-ethylsulfonylpropoxy)benzenesulfonamide (PubChem CID 65098440) has the molecular formula C11H15Cl2NO5S2 and a molecular weight of 376.28 g/mol. Its IUPAC name is 2,3-dichloro-4-(3-ethylsulfonylpropoxy)benzenesulfonamide.
| Compound Name | 2,3-dichloro-4-(3-ethylsulfonylpropoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 65098440 |
| Molecular Formula | C11H15Cl2NO5S2 |
| Molecular Weight | 376.28 g/mol |
| Exact Mass | 374.98 |
| IUPAC Name | 2,3-dichloro-4-(3-ethylsulfonylpropoxy)benzenesulfonamide |
| SMILES | CCS(=O)(=O)CCCOc1ccc(S(N)(=O)=O)c(Cl)c1Cl |
| InChI | InChI=1S/C11H15Cl2NO5S2/c1-2-20(15,16)7-3-6-19-8-4-5-9(21(14,17)18)11(13)10(8)12/h4-5H,2-3,6-7H2,1H3,(H2,14,17,18) |
| InChIKey | APELGKWTCVGQNA-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 103.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.28 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|