C11H8Br2F3NO3 — CID 107738387
2-(2,6-dibromo-4-formylphenoxy)-N-(2,2,2-trifluoroethyl)acetamide (PubChem CID 107738387) has the molecular formula C11H8Br2F3NO3 and a molecular weight of 418.99 g/mol. Its IUPAC name is 2-(2,6-dibromo-4-formylphenoxy)-N-(2,2,2-trifluoroethyl)acetamide.
| Compound Name | 2-(2,6-dibromo-4-formylphenoxy)-N-(2,2,2-trifluoroethyl)acetamide |
|---|---|
| PubChem CID | 107738387 |
| Molecular Formula | C11H8Br2F3NO3 |
| Molecular Weight | 418.99 g/mol |
| Exact Mass | 416.88 |
| IUPAC Name | 2-(2,6-dibromo-4-formylphenoxy)-N-(2,2,2-trifluoroethyl)acetamide |
| SMILES | O=Cc1cc(Br)c(OCC(=O)NCC(F)(F)F)c(Br)c1 |
| InChI | InChI=1S/C11H8Br2F3NO3/c12-7-1-6(3-18)2-8(13)10(7)20-4-9(19)17-5-11(14,15)16/h1-3H,4-5H2,(H,17,19) |
| InChIKey | GHDONNXHXNACHE-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.99 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|