C11H9Br2ClO2 — CID 106438593
3,5-dibromo-4-(3-chloro-2-methylprop-2-enoxy)benzaldehyde (PubChem CID 106438593) has the molecular formula C11H9Br2ClO2 and a molecular weight of 368.45 g/mol. Its IUPAC name is 3,5-dibromo-4-(3-chloro-2-methylprop-2-enoxy)benzaldehyde.
| Compound Name | 3,5-dibromo-4-(3-chloro-2-methylprop-2-enoxy)benzaldehyde |
|---|---|
| PubChem CID | 106438593 |
| Molecular Formula | C11H9Br2ClO2 |
| Molecular Weight | 368.45 g/mol |
| Exact Mass | 365.87 |
| IUPAC Name | 3,5-dibromo-4-(3-chloro-2-methylprop-2-enoxy)benzaldehyde |
| SMILES | CC(=CCl)COc1c(Br)cc(C=O)cc1Br |
| InChI | InChI=1S/C11H9Br2ClO2/c1-7(4-14)6-16-11-9(12)2-8(5-15)3-10(11)13/h2-5H,6H2,1H3 |
| InChIKey | NRRJKERKBQBPSS-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.45 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|