C9H6BrIO4 — CID 4763787
2-(2-bromo-4-formyl-6-iodophenoxy)acetic acid (PubChem CID 4763787) has the molecular formula C9H6BrIO4 and a molecular weight of 384.95 g/mol. Its IUPAC name is 2-(2-bromo-4-formyl-6-iodophenoxy)acetic acid.
| Compound Name | 2-(2-bromo-4-formyl-6-iodophenoxy)acetic acid |
|---|---|
| PubChem CID | 4763787 |
| Molecular Formula | C9H6BrIO4 |
| Molecular Weight | 384.95 g/mol |
| Exact Mass | 383.85 |
| IUPAC Name | 2-(2-bromo-4-formyl-6-iodophenoxy)acetic acid |
| SMILES | O=Cc1cc(Br)c(OCC(=O)O)c(I)c1 |
| InChI | InChI=1S/C9H6BrIO4/c10-6-1-5(3-12)2-7(11)9(6)15-4-8(13)14/h1-3H,4H2,(H,13,14) |
| InChIKey | QHPRCCIUEJTRPK-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.95 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|