C9H10BrNO3 — CID 130156250
2-(4-amino-2-bromo-6-methylphenoxy)acetic acid (PubChem CID 130156250) has the molecular formula C9H10BrNO3 and a molecular weight of 260.09 g/mol. Its IUPAC name is 2-(4-amino-2-bromo-6-methylphenoxy)acetic acid.
| Compound Name | 2-(4-amino-2-bromo-6-methylphenoxy)acetic acid |
|---|---|
| PubChem CID | 130156250 |
| Molecular Formula | C9H10BrNO3 |
| Molecular Weight | 260.09 g/mol |
| Exact Mass | 258.98 |
| IUPAC Name | 2-(4-amino-2-bromo-6-methylphenoxy)acetic acid |
| SMILES | Cc1cc(N)cc(Br)c1OCC(=O)O |
| InChI | InChI=1S/C9H10BrNO3/c1-5-2-6(11)3-7(10)9(5)14-4-8(12)13/h2-3H,4,11H2,1H3,(H,12,13) |
| InChIKey | JSBARVGAJOAOBR-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.09 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|