C14H11Br2NO4 — CID 68839222
2-[4-(4-aminophenoxy)-3,5-dibromophenoxy]acetic acid (PubChem CID 68839222) has the molecular formula C14H11Br2NO4 and a molecular weight of 417.05 g/mol. Its IUPAC name is 2-[4-(4-aminophenoxy)-3,5-dibromophenoxy]acetic acid.
| Compound Name | 2-[4-(4-aminophenoxy)-3,5-dibromophenoxy]acetic acid |
|---|---|
| PubChem CID | 68839222 |
| Molecular Formula | C14H11Br2NO4 |
| Molecular Weight | 417.05 g/mol |
| Exact Mass | 414.91 |
| IUPAC Name | 2-[4-(4-aminophenoxy)-3,5-dibromophenoxy]acetic acid |
| SMILES | Nc1ccc(Oc2c(Br)cc(OCC(=O)O)cc2Br)cc1 |
| InChI | InChI=1S/C14H11Br2NO4/c15-11-5-10(20-7-13(18)19)6-12(16)14(11)21-9-3-1-8(17)2-4-9/h1-6H,7,17H2,(H,18,19) |
| InChIKey | REPZAHOXQAWYAL-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.05 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|