C10H11BrO3 — CID 14207512
2-(4-bromo-3-ethylphenoxy)acetic acid (PubChem CID 14207512) has the molecular formula C10H11BrO3 and a molecular weight of 259.10 g/mol. Its IUPAC name is 2-(4-bromo-3-ethylphenoxy)acetic acid.
| Compound Name | 2-(4-bromo-3-ethylphenoxy)acetic acid |
|---|---|
| PubChem CID | 14207512 |
| Molecular Formula | C10H11BrO3 |
| Molecular Weight | 259.10 g/mol |
| Exact Mass | 257.99 |
| IUPAC Name | 2-(4-bromo-3-ethylphenoxy)acetic acid |
| SMILES | CCc1cc(OCC(=O)O)ccc1Br |
| InChI | InChI=1S/C10H11BrO3/c1-2-7-5-8(3-4-9(7)11)14-6-10(12)13/h3-5H,2,6H2,1H3,(H,12,13) |
| InChIKey | OACYRJMURIKUCV-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.10 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |