C10H11BrO4 — CID 172907938
2-(2-bromo-6-methoxy-4-methylphenoxy)acetic acid (PubChem CID 172907938) has the molecular formula C10H11BrO4 and a molecular weight of 275.10 g/mol. Its IUPAC name is 2-(2-bromo-6-methoxy-4-methylphenoxy)acetic acid.
| Compound Name | 2-(2-bromo-6-methoxy-4-methylphenoxy)acetic acid |
|---|---|
| PubChem CID | 172907938 |
| Molecular Formula | C10H11BrO4 |
| Molecular Weight | 275.10 g/mol |
| Exact Mass | 273.98 |
| IUPAC Name | 2-(2-bromo-6-methoxy-4-methylphenoxy)acetic acid |
| SMILES | COc1cc(C)cc(Br)c1OCC(=O)O |
| InChI | InChI=1S/C10H11BrO4/c1-6-3-7(11)10(8(4-6)14-2)15-5-9(12)13/h3-4H,5H2,1-2H3,(H,12,13) |
| InChIKey | CFDMUEOQGVOYGU-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.10 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |