C11H13BrO5 — CID 121210363
2-(5-bromo-2-ethoxy-3-methoxyphenoxy)acetic acid (PubChem CID 121210363) has the molecular formula C11H13BrO5 and a molecular weight of 305.12 g/mol. Its IUPAC name is 2-(5-bromo-2-ethoxy-3-methoxyphenoxy)acetic acid.
| Compound Name | 2-(5-bromo-2-ethoxy-3-methoxyphenoxy)acetic acid |
|---|---|
| PubChem CID | 121210363 |
| Molecular Formula | C11H13BrO5 |
| Molecular Weight | 305.12 g/mol |
| Exact Mass | 303.99 |
| IUPAC Name | 2-(5-bromo-2-ethoxy-3-methoxyphenoxy)acetic acid |
| SMILES | CCOc1c(OC)cc(Br)cc1OCC(=O)O |
| InChI | InChI=1S/C11H13BrO5/c1-3-16-11-8(15-2)4-7(12)5-9(11)17-6-10(13)14/h4-5H,3,6H2,1-2H3,(H,13,14) |
| InChIKey | QGZGVGUAIVLOFP-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.12 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |