C13H11BrN2O5S — CID 50871453
2-[2-bromo-6-methoxy-4-[(E)-(5-oxo-2-sulfanylideneimidazolidin-4-ylidene)methyl]phenoxy]acetic acid (PubChem CID 50871453) has the molecular formula C13H11BrN2O5S and a molecular weight of 387.21 g/mol. Its IUPAC name is 2-[2-bromo-6-methoxy-4-[(E)-(5-oxo-2-sulfanylideneimidazolidin-4-ylidene)methyl]phenoxy]acetic acid.
| Compound Name | 2-[2-bromo-6-methoxy-4-[(E)-(5-oxo-2-sulfanylideneimidazolidin-4-ylidene)methyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 50871453 |
| Molecular Formula | C13H11BrN2O5S |
| Molecular Weight | 387.21 g/mol |
| Exact Mass | 385.96 |
| IUPAC Name | 2-[2-bromo-6-methoxy-4-[(E)-(5-oxo-2-sulfanylideneimidazolidin-4-ylidene)methyl]phenoxy]acetic acid |
| SMILES | COc1cc(/C=C2/NC(=S)NC2=O)cc(Br)c1OCC(=O)O |
| InChI | InChI=1S/C13H11BrN2O5S/c1-20-9-4-6(3-8-12(19)16-13(22)15-8)2-7(14)11(9)21-5-10(17)18/h2-4H,5H2,1H3,(H,17,18)(H2,15,16,19,22)/b8-3+ |
| InChIKey | RCNDQRANYAWMSG-FPYGCLRLSA-N |
| XLogP | 1.27 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.21 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|