C20H14BrClN2O7 — CID 126048322
2-[2-bromo-4-[(E)-[1-(2-chlorophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]-6-methoxyphenoxy]acetic acid (PubChem CID 126048322) has the molecular formula C20H14BrClN2O7 and a molecular weight of 509.70 g/mol. Its IUPAC name is 2-[2-bromo-4-[(E)-[1-(2-chlorophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]-6-methoxyphenoxy]acetic acid.
| Compound Name | 2-[2-bromo-4-[(E)-[1-(2-chlorophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]-6-methoxyphenoxy]acetic acid |
|---|---|
| PubChem CID | 126048322 |
| Molecular Formula | C20H14BrClN2O7 |
| Molecular Weight | 509.70 g/mol |
| Exact Mass | 507.97 |
| IUPAC Name | 2-[2-bromo-4-[(E)-[1-(2-chlorophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]-6-methoxyphenoxy]acetic acid |
| SMILES | COc1cc(/C=C2\C(=O)NC(=O)N(c3ccccc3Cl)C2=O)cc(Br)c1OCC(=O)O |
| InChI | InChI=1S/C20H14BrClN2O7/c1-30-15-8-10(7-12(21)17(15)31-9-16(25)26)6-11-18(27)23-20(29)24(19(11)28)14-5-3-2-4-13(14)22/h2-8H,9H2,1H3,(H,25,26)(H,23,27,29)/b11-6+ |
| InChIKey | KPZPYJMQHVZHDJ-IZZDOVSWSA-N |
| XLogP | 3.24 |
| TPSA | 122.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.70 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|