C23H21BrN2O7 — CID 3843870
2-[2-bromo-6-methoxy-4-[[2,4,6-trioxo-1-(4-propan-2-ylphenyl)-1,3-diazinan-5-ylidene]methyl]phenoxy]acetic acid (PubChem CID 3843870) has the molecular formula C23H21BrN2O7 and a molecular weight of 517.33 g/mol. Its IUPAC name is 2-[2-bromo-6-methoxy-4-[[2,4,6-trioxo-1-(4-propan-2-ylphenyl)-1,3-diazinan-5-ylidene]methyl]phenoxy]acetic acid.
| Compound Name | 2-[2-bromo-6-methoxy-4-[[2,4,6-trioxo-1-(4-propan-2-ylphenyl)-1,3-diazinan-5-ylidene]methyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 3843870 |
| Molecular Formula | C23H21BrN2O7 |
| Molecular Weight | 517.33 g/mol |
| Exact Mass | 516.05 |
| IUPAC Name | 2-[2-bromo-6-methoxy-4-[[2,4,6-trioxo-1-(4-propan-2-ylphenyl)-1,3-diazinan-5-ylidene]methyl]phenoxy]acetic acid |
| SMILES | COc1cc(C=C2C(=O)NC(=O)N(c3ccc(C(C)C)cc3)C2=O)cc(Br)c1OCC(=O)O |
| InChI | InChI=1S/C23H21BrN2O7/c1-12(2)14-4-6-15(7-5-14)26-22(30)16(21(29)25-23(26)31)8-13-9-17(24)20(18(10-13)32-3)33-11-19(27)28/h4-10,12H,11H2,1-3H3,(H,27,28)(H,25,29,31) |
| InChIKey | IJLAPYORPLVHMH-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 122.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.33 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|