C10H11BrO5 — CID 97179050
2-[3-bromo-2-(hydroxymethyl)-6-methoxyphenoxy]acetic acid (PubChem CID 97179050) has the molecular formula C10H11BrO5 and a molecular weight of 291.10 g/mol. Its IUPAC name is 2-[3-bromo-2-(hydroxymethyl)-6-methoxyphenoxy]acetic acid.
| Compound Name | 2-[3-bromo-2-(hydroxymethyl)-6-methoxyphenoxy]acetic acid |
|---|---|
| PubChem CID | 97179050 |
| Molecular Formula | C10H11BrO5 |
| Molecular Weight | 291.10 g/mol |
| Exact Mass | 289.98 |
| IUPAC Name | 2-[3-bromo-2-(hydroxymethyl)-6-methoxyphenoxy]acetic acid |
| SMILES | COc1ccc(Br)c(CO)c1OCC(=O)O |
| InChI | InChI=1S/C10H11BrO5/c1-15-8-3-2-7(11)6(4-12)10(8)16-5-9(13)14/h2-3,12H,4-5H2,1H3,(H,13,14) |
| InChIKey | NBUWEEWNCNTLEL-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.10 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |