C14H11BrINO5S — CID 126109572
2-[2-bromo-4-[(E)-(3-ethyl-2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-6-iodophenoxy]acetic acid (PubChem CID 126109572) has the molecular formula C14H11BrINO5S and a molecular weight of 512.12 g/mol. Its IUPAC name is 2-[2-bromo-4-[(E)-(3-ethyl-2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-6-iodophenoxy]acetic acid.
| Compound Name | 2-[2-bromo-4-[(E)-(3-ethyl-2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-6-iodophenoxy]acetic acid |
|---|---|
| PubChem CID | 126109572 |
| Molecular Formula | C14H11BrINO5S |
| Molecular Weight | 512.12 g/mol |
| Exact Mass | 510.86 |
| IUPAC Name | 2-[2-bromo-4-[(E)-(3-ethyl-2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-6-iodophenoxy]acetic acid |
| SMILES | CCN1C(=O)S/C(=C/c2cc(Br)c(OCC(=O)O)c(I)c2)C1=O |
| InChI | InChI=1S/C14H11BrINO5S/c1-2-17-13(20)10(23-14(17)21)5-7-3-8(15)12(9(16)4-7)22-6-11(18)19/h3-5H,2,6H2,1H3,(H,18,19)/b10-5+ |
| InChIKey | XNPOGRSYAHHEEP-BJMVGYQFSA-N |
| XLogP | 3.57 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.12 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_B(16)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|