C20H13BrFIN2O6S — CID 126250648
2-[2-bromo-4-[(E)-[3-[2-(3-fluoroanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-6-iodophenoxy]acetic acid (PubChem CID 126250648) has the molecular formula C20H13BrFIN2O6S and a molecular weight of 635.21 g/mol. Its IUPAC name is 2-[2-bromo-4-[(E)-[3-[2-(3-fluoroanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-6-iodophenoxy]acetic acid.
| Compound Name | 2-[2-bromo-4-[(E)-[3-[2-(3-fluoroanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-6-iodophenoxy]acetic acid |
|---|---|
| PubChem CID | 126250648 |
| Molecular Formula | C20H13BrFIN2O6S |
| Molecular Weight | 635.21 g/mol |
| Exact Mass | 633.87 |
| IUPAC Name | 2-[2-bromo-4-[(E)-[3-[2-(3-fluoroanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-6-iodophenoxy]acetic acid |
| SMILES | O=C(O)COc1c(Br)cc(/C=C2/SC(=O)N(CC(=O)Nc3cccc(F)c3)C2=O)cc1I |
| InChI | InChI=1S/C20H13BrFIN2O6S/c21-13-4-10(5-14(23)18(13)31-9-17(27)28)6-15-19(29)25(20(30)32-15)8-16(26)24-12-3-1-2-11(22)7-12/h1-7H,8-9H2,(H,24,26)(H,27,28)/b15-6+ |
| InChIKey | DBAOPBNQKTVNJW-GIDUJCDVSA-N |
| XLogP | 4.33 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.21 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_B(16)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|