C21H16BrFN2O7S — CID 126255481
2-[2-bromo-4-[(E)-[3-[2-(3-fluoroanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-6-methoxyphenoxy]acetic acid (PubChem CID 126255481) has the molecular formula C21H16BrFN2O7S and a molecular weight of 539.34 g/mol. Its IUPAC name is 2-[2-bromo-4-[(E)-[3-[2-(3-fluoroanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-6-methoxyphenoxy]acetic acid.
| Compound Name | 2-[2-bromo-4-[(E)-[3-[2-(3-fluoroanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-6-methoxyphenoxy]acetic acid |
|---|---|
| PubChem CID | 126255481 |
| Molecular Formula | C21H16BrFN2O7S |
| Molecular Weight | 539.34 g/mol |
| Exact Mass | 537.98 |
| IUPAC Name | 2-[2-bromo-4-[(E)-[3-[2-(3-fluoroanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-6-methoxyphenoxy]acetic acid |
| SMILES | COc1cc(/C=C2/SC(=O)N(CC(=O)Nc3cccc(F)c3)C2=O)cc(Br)c1OCC(=O)O |
| InChI | InChI=1S/C21H16BrFN2O7S/c1-31-15-6-11(5-14(22)19(15)32-10-18(27)28)7-16-20(29)25(21(30)33-16)9-17(26)24-13-4-2-3-12(23)8-13/h2-8H,9-10H2,1H3,(H,24,26)(H,27,28)/b16-7+ |
| InChIKey | KBHQSRCXGDAKIE-FRKPEAEDSA-N |
| XLogP | 3.74 |
| TPSA | 122.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.34 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|