C16H16I2N2O4S — CID 3959365
2-[4-[(3-ethyl-2-ethylimino-4-oxo-1,3-thiazolidin-5-ylidene)methyl]-2,6-diiodophenoxy]acetic acid (PubChem CID 3959365) has the molecular formula C16H16I2N2O4S and a molecular weight of 586.19 g/mol. Its IUPAC name is 2-[4-[(3-ethyl-2-ethylimino-4-oxo-1,3-thiazolidin-5-ylidene)methyl]-2,6-diiodophenoxy]acetic acid.
| Compound Name | 2-[4-[(3-ethyl-2-ethylimino-4-oxo-1,3-thiazolidin-5-ylidene)methyl]-2,6-diiodophenoxy]acetic acid |
|---|---|
| PubChem CID | 3959365 |
| Molecular Formula | C16H16I2N2O4S |
| Molecular Weight | 586.19 g/mol |
| Exact Mass | 585.89 |
| IUPAC Name | 2-[4-[(3-ethyl-2-ethylimino-4-oxo-1,3-thiazolidin-5-ylidene)methyl]-2,6-diiodophenoxy]acetic acid |
| SMILES | CC/N=C1/SC(=Cc2cc(I)c(OCC(=O)O)c(I)c2)C(=O)N1CC |
| InChI | InChI=1S/C16H16I2N2O4S/c1-3-19-16-20(4-2)15(23)12(25-16)7-9-5-10(17)14(11(18)6-9)24-8-13(21)22/h5-7H,3-4,8H2,1-2H3,(H,21,22)/b12-7?,19-16+ |
| InChIKey | DNDRHWSDIWUTRS-NBPAWREGSA-N |
| XLogP | 3.67 |
| TPSA | 79.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.19 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|