C22H21Cl2IN2O3S — CID 124532238
(5Z)-5-[[4-[(3,4-dichlorophenyl)methoxy]-3-iodo-5-methoxyphenyl]methylidene]-3-ethyl-2-ethylimino-1,3-thiazolidin-4-one (PubChem CID 124532238) has the molecular formula C22H21Cl2IN2O3S and a molecular weight of 591.30 g/mol. Its IUPAC name is (5Z)-5-[[4-[(3,4-dichlorophenyl)methoxy]-3-iodo-5-methoxyphenyl]methylidene]-3-ethyl-2-ethylimino-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[[4-[(3,4-dichlorophenyl)methoxy]-3-iodo-5-methoxyphenyl]methylidene]-3-ethyl-2-ethylimino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 124532238 |
| Molecular Formula | C22H21Cl2IN2O3S |
| Molecular Weight | 591.30 g/mol |
| Exact Mass | 589.97 |
| IUPAC Name | (5Z)-5-[[4-[(3,4-dichlorophenyl)methoxy]-3-iodo-5-methoxyphenyl]methylidene]-3-ethyl-2-ethylimino-1,3-thiazolidin-4-one |
| SMILES | CC/N=C1/S/C(=C\c2cc(I)c(OCc3ccc(Cl)c(Cl)c3)c(OC)c2)C(=O)N1CC |
| InChI | InChI=1S/C22H21Cl2IN2O3S/c1-4-26-22-27(5-2)21(28)19(31-22)11-14-9-17(25)20(18(10-14)29-3)30-12-13-6-7-15(23)16(24)8-13/h6-11H,4-5,12H2,1-3H3/b19-11-,26-22+ |
| InChIKey | FAMFQUOYBVJSQA-LPBWDIHSSA-N |
| XLogP | 6.50 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.30 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|