C32H26ClIN2O3S — CID 126085330
(5E)-3-benzyl-2-benzylimino-5-[[4-[(3-chlorophenyl)methoxy]-3-iodo-5-methoxyphenyl]methylidene]-1,3-thiazolidin-4-one (PubChem CID 126085330) has the molecular formula C32H26ClIN2O3S and a molecular weight of 681.00 g/mol. Its IUPAC name is (5E)-3-benzyl-2-benzylimino-5-[[4-[(3-chlorophenyl)methoxy]-3-iodo-5-methoxyphenyl]methylidene]-1,3-thiazolidin-4-one.
| Compound Name | (5E)-3-benzyl-2-benzylimino-5-[[4-[(3-chlorophenyl)methoxy]-3-iodo-5-methoxyphenyl]methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 126085330 |
| Molecular Formula | C32H26ClIN2O3S |
| Molecular Weight | 681.00 g/mol |
| Exact Mass | 680.04 |
| IUPAC Name | (5E)-3-benzyl-2-benzylimino-5-[[4-[(3-chlorophenyl)methoxy]-3-iodo-5-methoxyphenyl]methylidene]-1,3-thiazolidin-4-one |
| SMILES | COc1cc(/C=C2/S/C(=N\Cc3ccccc3)N(Cc3ccccc3)C2=O)cc(I)c1OCc1cccc(Cl)c1 |
| InChI | InChI=1S/C32H26ClIN2O3S/c1-38-28-17-25(16-27(34)30(28)39-21-24-13-8-14-26(33)15-24)18-29-31(37)36(20-23-11-6-3-7-12-23)32(40-29)35-19-22-9-4-2-5-10-22/h2-18H,19-21H2,1H3/b29-18+,35-32- |
| InChIKey | JRJJUADPMVLGEA-DUSCKAATSA-N |
| XLogP | 8.20 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.00 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|