C28H25ClN2O3S — CID 126086277
(5E)-3-benzyl-2-benzylimino-5-[(3-chloro-5-methoxy-4-prop-2-enoxyphenyl)methylidene]-1,3-thiazolidin-4-one (PubChem CID 126086277) has the molecular formula C28H25ClN2O3S and a molecular weight of 505.04 g/mol. Its IUPAC name is (5E)-3-benzyl-2-benzylimino-5-[(3-chloro-5-methoxy-4-prop-2-enoxyphenyl)methylidene]-1,3-thiazolidin-4-one.
| Compound Name | (5E)-3-benzyl-2-benzylimino-5-[(3-chloro-5-methoxy-4-prop-2-enoxyphenyl)methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 126086277 |
| Molecular Formula | C28H25ClN2O3S |
| Molecular Weight | 505.04 g/mol |
| Exact Mass | 504.13 |
| IUPAC Name | (5E)-3-benzyl-2-benzylimino-5-[(3-chloro-5-methoxy-4-prop-2-enoxyphenyl)methylidene]-1,3-thiazolidin-4-one |
| SMILES | C=CCOc1c(Cl)cc(/C=C2/S/C(=N\Cc3ccccc3)N(Cc3ccccc3)C2=O)cc1OC |
| InChI | InChI=1S/C28H25ClN2O3S/c1-3-14-34-26-23(29)15-22(16-24(26)33-2)17-25-27(32)31(19-21-12-8-5-9-13-21)28(35-25)30-18-20-10-6-4-7-11-20/h3-13,15-17H,1,14,18-19H2,2H3/b25-17+,30-28- |
| InChIKey | KCIUCPOLZHQRCO-MVTOYSBASA-N |
| XLogP | 6.59 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.04 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|