C33H27Cl3N2O3S — CID 126087553
(5E)-3-benzyl-2-benzylimino-5-[[3-chloro-4-[(2,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]methylidene]-1,3-thiazolidin-4-one (PubChem CID 126087553) has the molecular formula C33H27Cl3N2O3S and a molecular weight of 638.02 g/mol. Its IUPAC name is (5E)-3-benzyl-2-benzylimino-5-[[3-chloro-4-[(2,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]methylidene]-1,3-thiazolidin-4-one.
| Compound Name | (5E)-3-benzyl-2-benzylimino-5-[[3-chloro-4-[(2,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 126087553 |
| Molecular Formula | C33H27Cl3N2O3S |
| Molecular Weight | 638.02 g/mol |
| Exact Mass | 636.08 |
| IUPAC Name | (5E)-3-benzyl-2-benzylimino-5-[[3-chloro-4-[(2,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]methylidene]-1,3-thiazolidin-4-one |
| SMILES | CCOc1cc(/C=C2/S/C(=N\Cc3ccccc3)N(Cc3ccccc3)C2=O)cc(Cl)c1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C33H27Cl3N2O3S/c1-2-40-29-16-24(15-28(36)31(29)41-21-25-13-14-26(34)18-27(25)35)17-30-32(39)38(20-23-11-7-4-8-12-23)33(42-30)37-19-22-9-5-3-6-10-22/h3-18H,2,19-21H2,1H3/b30-17+,37-33- |
| InChIKey | GOZKCRPWWAQMKQ-HCPBQDIISA-N |
| XLogP | 9.30 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.02 |
| LogP ≤ 5 | 9.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|