C23H15I2NO5S — CID 21376803
2-[2,6-diiodo-4-[(E)-[3-(naphthalen-1-ylmethyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetic acid (PubChem CID 21376803) has the molecular formula C23H15I2NO5S and a molecular weight of 671.25 g/mol. Its IUPAC name is 2-[2,6-diiodo-4-[(E)-[3-(naphthalen-1-ylmethyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetic acid.
| Compound Name | 2-[2,6-diiodo-4-[(E)-[3-(naphthalen-1-ylmethyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 21376803 |
| Molecular Formula | C23H15I2NO5S |
| Molecular Weight | 671.25 g/mol |
| Exact Mass | 670.88 |
| IUPAC Name | 2-[2,6-diiodo-4-[(E)-[3-(naphthalen-1-ylmethyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetic acid |
| SMILES | O=C(O)COc1c(I)cc(/C=C2/SC(=O)N(Cc3cccc4ccccc34)C2=O)cc1I |
| InChI | InChI=1S/C23H15I2NO5S/c24-17-8-13(9-18(25)21(17)31-12-20(27)28)10-19-22(29)26(23(30)32-19)11-15-6-3-5-14-4-1-2-7-16(14)15/h1-10H,11-12H2,(H,27,28)/b19-10+ |
| InChIKey | HCRUPVPRKKDXJH-VXLYETTFSA-N |
| XLogP | 5.75 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.25 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_B(16)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|