C30H22INO6S — CID 21377275
3-[[2-iodo-6-methoxy-4-[(E)-[3-(naphthalen-1-ylmethyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]methyl]benzoic acid (PubChem CID 21377275) has the molecular formula C30H22INO6S and a molecular weight of 651.48 g/mol. Its IUPAC name is 3-[[2-iodo-6-methoxy-4-[(E)-[3-(naphthalen-1-ylmethyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]methyl]benzoic acid.
| Compound Name | 3-[[2-iodo-6-methoxy-4-[(E)-[3-(naphthalen-1-ylmethyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 21377275 |
| Molecular Formula | C30H22INO6S |
| Molecular Weight | 651.48 g/mol |
| Exact Mass | 651.02 |
| IUPAC Name | 3-[[2-iodo-6-methoxy-4-[(E)-[3-(naphthalen-1-ylmethyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]methyl]benzoic acid |
| SMILES | COc1cc(/C=C2/SC(=O)N(Cc3cccc4ccccc34)C2=O)cc(I)c1OCc1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C30H22INO6S/c1-37-25-14-19(13-24(31)27(25)38-17-18-6-4-9-21(12-18)29(34)35)15-26-28(33)32(30(36)39-26)16-22-10-5-8-20-7-2-3-11-23(20)22/h2-15H,16-17H2,1H3,(H,34,35)/b26-15+ |
| InChIKey | QWDFRFUKUXJQAC-CVKSISIWSA-N |
| XLogP | 6.97 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.48 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|