C31H24ClNO6S — CID 21377295
3-[[2-chloro-6-ethoxy-4-[(E)-[3-(naphthalen-1-ylmethyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]methyl]benzoic acid (PubChem CID 21377295) has the molecular formula C31H24ClNO6S and a molecular weight of 574.05 g/mol. Its IUPAC name is 3-[[2-chloro-6-ethoxy-4-[(E)-[3-(naphthalen-1-ylmethyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]methyl]benzoic acid.
| Compound Name | 3-[[2-chloro-6-ethoxy-4-[(E)-[3-(naphthalen-1-ylmethyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 21377295 |
| Molecular Formula | C31H24ClNO6S |
| Molecular Weight | 574.05 g/mol |
| Exact Mass | 573.10 |
| IUPAC Name | 3-[[2-chloro-6-ethoxy-4-[(E)-[3-(naphthalen-1-ylmethyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]methyl]benzoic acid |
| SMILES | CCOc1cc(/C=C2/SC(=O)N(Cc3cccc4ccccc34)C2=O)cc(Cl)c1OCc1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C31H24ClNO6S/c1-2-38-26-15-20(14-25(32)28(26)39-18-19-7-5-10-22(13-19)30(35)36)16-27-29(34)33(31(37)40-27)17-23-11-6-9-21-8-3-4-12-24(21)23/h3-16H,2,17-18H2,1H3,(H,35,36)/b27-16+ |
| InChIKey | ROHDCUHPHPFVSK-JVWAILMASA-N |
| XLogP | 7.41 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.05 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|