C32H30ClN3O7S — CID 126024701
3-[[2-chloro-4-[(E)-[2,4-dioxo-3-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]-1,3-thiazolidin-5-ylidene]methyl]-6-ethoxyphenoxy]methyl]benzoic acid (PubChem CID 126024701) has the molecular formula C32H30ClN3O7S and a molecular weight of 636.13 g/mol. Its IUPAC name is 3-[[2-chloro-4-[(E)-[2,4-dioxo-3-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]-1,3-thiazolidin-5-ylidene]methyl]-6-ethoxyphenoxy]methyl]benzoic acid.
| Compound Name | 3-[[2-chloro-4-[(E)-[2,4-dioxo-3-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]-1,3-thiazolidin-5-ylidene]methyl]-6-ethoxyphenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 126024701 |
| Molecular Formula | C32H30ClN3O7S |
| Molecular Weight | 636.13 g/mol |
| Exact Mass | 635.15 |
| IUPAC Name | 3-[[2-chloro-4-[(E)-[2,4-dioxo-3-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]-1,3-thiazolidin-5-ylidene]methyl]-6-ethoxyphenoxy]methyl]benzoic acid |
| SMILES | CCOc1cc(/C=C2/SC(=O)N(CC(=O)N3CCN(c4ccccc4)CC3)C2=O)cc(Cl)c1OCc1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C32H30ClN3O7S/c1-2-42-26-17-22(16-25(33)29(26)43-20-21-7-6-8-23(15-21)31(39)40)18-27-30(38)36(32(41)44-27)19-28(37)35-13-11-34(12-14-35)24-9-4-3-5-10-24/h3-10,15-18H,2,11-14,19-20H2,1H3,(H,39,40)/b27-18+ |
| InChIKey | XMPCUDDZARTMSH-OVVQPSECSA-N |
| XLogP | 5.40 |
| TPSA | 116.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.13 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|