C28H29IN2O7S — CID 4237276
3-[[4-[[3-[2-(azepan-1-yl)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2-ethoxy-6-iodophenoxy]methyl]benzoic acid (PubChem CID 4237276) has the molecular formula C28H29IN2O7S and a molecular weight of 664.52 g/mol. Its IUPAC name is 3-[[4-[[3-[2-(azepan-1-yl)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2-ethoxy-6-iodophenoxy]methyl]benzoic acid.
| Compound Name | 3-[[4-[[3-[2-(azepan-1-yl)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2-ethoxy-6-iodophenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 4237276 |
| Molecular Formula | C28H29IN2O7S |
| Molecular Weight | 664.52 g/mol |
| Exact Mass | 664.07 |
| IUPAC Name | 3-[[4-[[3-[2-(azepan-1-yl)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2-ethoxy-6-iodophenoxy]methyl]benzoic acid |
| SMILES | CCOc1cc(C=C2SC(=O)N(CC(=O)N3CCCCCC3)C2=O)cc(I)c1OCc1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C28H29IN2O7S/c1-2-37-22-14-19(13-21(29)25(22)38-17-18-8-7-9-20(12-18)27(34)35)15-23-26(33)31(28(36)39-23)16-24(32)30-10-5-3-4-6-11-30/h7-9,12-15H,2-6,10-11,16-17H2,1H3,(H,34,35) |
| InChIKey | IJKIEEBLEYCQTB-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 113.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.52 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|