C32H28ClNO4S — CID 126135488
(5E)-5-[[3-chloro-5-ethoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylidene]-3-(3-phenylpropyl)-1,3-thiazolidine-2,4-dione (PubChem CID 126135488) has the molecular formula C32H28ClNO4S and a molecular weight of 558.10 g/mol. Its IUPAC name is (5E)-5-[[3-chloro-5-ethoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylidene]-3-(3-phenylpropyl)-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-[[3-chloro-5-ethoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylidene]-3-(3-phenylpropyl)-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126135488 |
| Molecular Formula | C32H28ClNO4S |
| Molecular Weight | 558.10 g/mol |
| Exact Mass | 557.14 |
| IUPAC Name | (5E)-5-[[3-chloro-5-ethoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylidene]-3-(3-phenylpropyl)-1,3-thiazolidine-2,4-dione |
| SMILES | CCOc1cc(/C=C2/SC(=O)N(CCCc3ccccc3)C2=O)cc(Cl)c1OCc1cccc2ccccc12 |
| InChI | InChI=1S/C32H28ClNO4S/c1-2-37-28-19-23(18-27(33)30(28)38-21-25-15-8-14-24-13-6-7-16-26(24)25)20-29-31(35)34(32(36)39-29)17-9-12-22-10-4-3-5-11-22/h3-8,10-11,13-16,18-20H,2,9,12,17,21H2,1H3/b29-20+ |
| InChIKey | RBGGBOVDSPITGJ-ZTKZIYFRSA-N |
| XLogP | 8.14 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.10 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|