C19H15IN2O5S — CID 4309882
3-[[4-[(2-amino-4-oxo-1,3-thiazol-5-ylidene)methyl]-2-iodo-6-methoxyphenoxy]methyl]benzoic acid (PubChem CID 4309882) has the molecular formula C19H15IN2O5S and a molecular weight of 510.31 g/mol. Its IUPAC name is 3-[[4-[(2-amino-4-oxo-1,3-thiazol-5-ylidene)methyl]-2-iodo-6-methoxyphenoxy]methyl]benzoic acid.
| Compound Name | 3-[[4-[(2-amino-4-oxo-1,3-thiazol-5-ylidene)methyl]-2-iodo-6-methoxyphenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 4309882 |
| Molecular Formula | C19H15IN2O5S |
| Molecular Weight | 510.31 g/mol |
| Exact Mass | 509.97 |
| IUPAC Name | 3-[[4-[(2-amino-4-oxo-1,3-thiazol-5-ylidene)methyl]-2-iodo-6-methoxyphenoxy]methyl]benzoic acid |
| SMILES | COc1cc(C=C2SC(N)=NC2=O)cc(I)c1OCc1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C19H15IN2O5S/c1-26-14-7-11(8-15-17(23)22-19(21)28-15)6-13(20)16(14)27-9-10-3-2-4-12(5-10)18(24)25/h2-8H,9H2,1H3,(H,24,25)(H2,21,22,23) |
| InChIKey | HIAQVJLBDXETNO-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 111.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.31 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|