C25H18FIN2O5S — CID 137079947
3-[[4-[(E)-[2-(4-fluorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2-iodo-6-methoxyphenoxy]methyl]benzoic acid (PubChem CID 137079947) has the molecular formula C25H18FIN2O5S and a molecular weight of 604.40 g/mol. Its IUPAC name is 3-[[4-[(E)-[2-(4-fluorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2-iodo-6-methoxyphenoxy]methyl]benzoic acid.
| Compound Name | 3-[[4-[(E)-[2-(4-fluorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2-iodo-6-methoxyphenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 137079947 |
| Molecular Formula | C25H18FIN2O5S |
| Molecular Weight | 604.40 g/mol |
| Exact Mass | 604.00 |
| IUPAC Name | 3-[[4-[(E)-[2-(4-fluorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2-iodo-6-methoxyphenoxy]methyl]benzoic acid |
| SMILES | COc1cc(/C=C2/S/C(=N\c3ccc(F)cc3)NC2=O)cc(I)c1OCc1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C25H18FIN2O5S/c1-33-20-11-15(10-19(27)22(20)34-13-14-3-2-4-16(9-14)24(31)32)12-21-23(30)29-25(35-21)28-18-7-5-17(26)6-8-18/h2-12H,13H2,1H3,(H,31,32)(H,28,29,30)/b21-12+ |
| InChIKey | DGCGKTTUSCJOJK-CIAFOILYSA-N |
| XLogP | 5.61 |
| TPSA | 97.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.40 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|