C18H13Cl2IN2O3S — CID 2872247
2-amino-5-[[4-[(2,4-dichlorophenyl)methoxy]-3-iodo-5-methoxyphenyl]methylidene]-1,3-thiazol-4-one (PubChem CID 2872247) has the molecular formula C18H13Cl2IN2O3S and a molecular weight of 535.19 g/mol. Its IUPAC name is 2-amino-5-[[4-[(2,4-dichlorophenyl)methoxy]-3-iodo-5-methoxyphenyl]methylidene]-1,3-thiazol-4-one.
| Compound Name | 2-amino-5-[[4-[(2,4-dichlorophenyl)methoxy]-3-iodo-5-methoxyphenyl]methylidene]-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 2872247 |
| Molecular Formula | C18H13Cl2IN2O3S |
| Molecular Weight | 535.19 g/mol |
| Exact Mass | 533.91 |
| IUPAC Name | 2-amino-5-[[4-[(2,4-dichlorophenyl)methoxy]-3-iodo-5-methoxyphenyl]methylidene]-1,3-thiazol-4-one |
| SMILES | COc1cc(C=C2SC(N)=NC2=O)cc(I)c1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C18H13Cl2IN2O3S/c1-25-14-5-9(6-15-17(24)23-18(22)27-15)4-13(21)16(14)26-8-10-2-3-11(19)7-12(10)20/h2-7H,8H2,1H3,(H2,22,23,24) |
| InChIKey | FVZBMIOBUNGZJA-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.19 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|