C27H22Cl3IN2O3S — CID 126096091
(5Z)-2-(4-chlorophenyl)imino-5-[[4-[(2,4-dichlorophenyl)methoxy]-3-iodo-5-methoxyphenyl]methylidene]-3-propyl-1,3-thiazolidin-4-one (PubChem CID 126096091) has the molecular formula C27H22Cl3IN2O3S and a molecular weight of 687.81 g/mol. Its IUPAC name is (5Z)-2-(4-chlorophenyl)imino-5-[[4-[(2,4-dichlorophenyl)methoxy]-3-iodo-5-methoxyphenyl]methylidene]-3-propyl-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-2-(4-chlorophenyl)imino-5-[[4-[(2,4-dichlorophenyl)methoxy]-3-iodo-5-methoxyphenyl]methylidene]-3-propyl-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 126096091 |
| Molecular Formula | C27H22Cl3IN2O3S |
| Molecular Weight | 687.81 g/mol |
| Exact Mass | 685.95 |
| IUPAC Name | (5Z)-2-(4-chlorophenyl)imino-5-[[4-[(2,4-dichlorophenyl)methoxy]-3-iodo-5-methoxyphenyl]methylidene]-3-propyl-1,3-thiazolidin-4-one |
| SMILES | CCCN1C(=O)/C(=C/c2cc(I)c(OCc3ccc(Cl)cc3Cl)c(OC)c2)S/C1=N/c1ccc(Cl)cc1 |
| InChI | InChI=1S/C27H22Cl3IN2O3S/c1-3-10-33-26(34)24(37-27(33)32-20-8-6-18(28)7-9-20)13-16-11-22(31)25(23(12-16)35-2)36-15-17-4-5-19(29)14-21(17)30/h4-9,11-14H,3,10,15H2,1-2H3/b24-13-,32-27+ |
| InChIKey | JTHFSUURADTMBN-VDGOXKQWSA-N |
| XLogP | 8.85 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.81 |
| LogP ≤ 5 | 8.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|