C21H20Cl2N2O3S — CID 126094323
(5Z)-5-[(2-chloro-4,5-dimethoxyphenyl)methylidene]-2-(4-chlorophenyl)imino-3-propyl-1,3-thiazolidin-4-one (PubChem CID 126094323) has the molecular formula C21H20Cl2N2O3S and a molecular weight of 451.38 g/mol. Its IUPAC name is (5Z)-5-[(2-chloro-4,5-dimethoxyphenyl)methylidene]-2-(4-chlorophenyl)imino-3-propyl-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[(2-chloro-4,5-dimethoxyphenyl)methylidene]-2-(4-chlorophenyl)imino-3-propyl-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 126094323 |
| Molecular Formula | C21H20Cl2N2O3S |
| Molecular Weight | 451.38 g/mol |
| Exact Mass | 450.06 |
| IUPAC Name | (5Z)-5-[(2-chloro-4,5-dimethoxyphenyl)methylidene]-2-(4-chlorophenyl)imino-3-propyl-1,3-thiazolidin-4-one |
| SMILES | CCCN1C(=O)/C(=C/c2cc(OC)c(OC)cc2Cl)S/C1=N/c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H20Cl2N2O3S/c1-4-9-25-20(26)19(29-21(25)24-15-7-5-14(22)6-8-15)11-13-10-17(27-2)18(28-3)12-16(13)23/h5-8,10-12H,4,9H2,1-3H3/b19-11-,24-21+ |
| InChIKey | DEUMBXQNVFNVSC-JXQPYYAVSA-N |
| XLogP | 6.02 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.38 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|