C20H17Cl2IN2O5S — CID 171155147
acetic acid;5-[[4-[(2,4-dichlorophenyl)methoxy]-3-iodo-5-methoxyphenyl]methylidene]-2-imino-1,3-thiazolidin-4-one (PubChem CID 171155147) has the molecular formula C20H17Cl2IN2O5S and a molecular weight of 595.24 g/mol. Its IUPAC name is acetic acid;5-[[4-[(2,4-dichlorophenyl)methoxy]-3-iodo-5-methoxyphenyl]methylidene]-2-imino-1,3-thiazolidin-4-one.
| Compound Name | acetic acid;5-[[4-[(2,4-dichlorophenyl)methoxy]-3-iodo-5-methoxyphenyl]methylidene]-2-imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 171155147 |
| Molecular Formula | C20H17Cl2IN2O5S |
| Molecular Weight | 595.24 g/mol |
| Exact Mass | 593.93 |
| IUPAC Name | acetic acid;5-[[4-[(2,4-dichlorophenyl)methoxy]-3-iodo-5-methoxyphenyl]methylidene]-2-imino-1,3-thiazolidin-4-one |
| SMILES | CC(=O)O.[H]/N=C1\NC(=O)C(=Cc2cc(I)c(OCc3ccc(Cl)cc3Cl)c(OC)c2)S1 |
| InChI | InChI=1S/C18H13Cl2IN2O3S.C2H4O2/c1-25-14-5-9(6-15-17(24)23-18(22)27-15)4-13(21)16(14)26-8-10-2-3-11(19)7-12(10)20;1-2(3)4/h2-7H,8H2,1H3,(H2,22,23,24);1H3,(H,3,4) |
| InChIKey | FTQOVKDNJPRHKE-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 108.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.24 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|