C24H15Cl2IO4 — CID 3935429
2-[[4-[(2,4-dichlorophenyl)methoxy]-3-iodo-5-methoxyphenyl]methylidene]indene-1,3-dione (PubChem CID 3935429) has the molecular formula C24H15Cl2IO4 and a molecular weight of 565.19 g/mol. Its IUPAC name is 2-[[4-[(2,4-dichlorophenyl)methoxy]-3-iodo-5-methoxyphenyl]methylidene]indene-1,3-dione.
| Compound Name | 2-[[4-[(2,4-dichlorophenyl)methoxy]-3-iodo-5-methoxyphenyl]methylidene]indene-1,3-dione |
|---|---|
| PubChem CID | 3935429 |
| Molecular Formula | C24H15Cl2IO4 |
| Molecular Weight | 565.19 g/mol |
| Exact Mass | 563.94 |
| IUPAC Name | 2-[[4-[(2,4-dichlorophenyl)methoxy]-3-iodo-5-methoxyphenyl]methylidene]indene-1,3-dione |
| SMILES | COc1cc(C=C2C(=O)c3ccccc3C2=O)cc(I)c1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C24H15Cl2IO4/c1-30-21-10-13(8-18-22(28)16-4-2-3-5-17(16)23(18)29)9-20(27)24(21)31-12-14-6-7-15(25)11-19(14)26/h2-11H,12H2,1H3 |
| InChIKey | BBUGSCOBGVSLLV-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.19 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|