C22H18Cl2INO3 — CID 126217637
1-[4-[(2,4-dichlorophenyl)methoxy]-3-iodo-5-methoxyphenyl]-N-(4-methoxyphenyl)methanimine (PubChem CID 126217637) has the molecular formula C22H18Cl2INO3 and a molecular weight of 542.20 g/mol. Its IUPAC name is 1-[4-[(2,4-dichlorophenyl)methoxy]-3-iodo-5-methoxyphenyl]-N-(4-methoxyphenyl)methanimine.
| Compound Name | 1-[4-[(2,4-dichlorophenyl)methoxy]-3-iodo-5-methoxyphenyl]-N-(4-methoxyphenyl)methanimine |
|---|---|
| PubChem CID | 126217637 |
| Molecular Formula | C22H18Cl2INO3 |
| Molecular Weight | 542.20 g/mol |
| Exact Mass | 540.97 |
| IUPAC Name | 1-[4-[(2,4-dichlorophenyl)methoxy]-3-iodo-5-methoxyphenyl]-N-(4-methoxyphenyl)methanimine |
| SMILES | COc1ccc(/N=C/c2cc(I)c(OCc3ccc(Cl)cc3Cl)c(OC)c2)cc1 |
| InChI | InChI=1S/C22H18Cl2INO3/c1-27-18-7-5-17(6-8-18)26-12-14-9-20(25)22(21(10-14)28-2)29-13-15-3-4-16(23)11-19(15)24/h3-12H,13H2,1-2H3/b26-12+ |
| InChIKey | NTRYATLXMFZNJI-RPPGKUMJSA-N |
| XLogP | 6.94 |
| TPSA | 40.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.20 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|