C13H16Br2O3 — CID 114265273
3,5-dibromo-4-(2-hydroxy-3,3-dimethylbutoxy)benzaldehyde (PubChem CID 114265273) has the molecular formula C13H16Br2O3 and a molecular weight of 380.08 g/mol. Its IUPAC name is 3,5-dibromo-4-(2-hydroxy-3,3-dimethylbutoxy)benzaldehyde.
| Compound Name | 3,5-dibromo-4-(2-hydroxy-3,3-dimethylbutoxy)benzaldehyde |
|---|---|
| PubChem CID | 114265273 |
| Molecular Formula | C13H16Br2O3 |
| Molecular Weight | 380.08 g/mol |
| Exact Mass | 377.95 |
| IUPAC Name | 3,5-dibromo-4-(2-hydroxy-3,3-dimethylbutoxy)benzaldehyde |
| SMILES | CC(C)(C)C(O)COc1c(Br)cc(C=O)cc1Br |
| InChI | InChI=1S/C13H16Br2O3/c1-13(2,3)11(17)7-18-12-9(14)4-8(6-16)5-10(12)15/h4-6,11,17H,7H2,1-3H3 |
| InChIKey | KMEXOPNGDGUHDU-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.08 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|