C12H14Br2O3 — CID 107738170
3,5-dibromo-4-(3-hydroxy-3-methylbutoxy)benzaldehyde (PubChem CID 107738170) has the molecular formula C12H14Br2O3 and a molecular weight of 366.05 g/mol. Its IUPAC name is 3,5-dibromo-4-(3-hydroxy-3-methylbutoxy)benzaldehyde.
| Compound Name | 3,5-dibromo-4-(3-hydroxy-3-methylbutoxy)benzaldehyde |
|---|---|
| PubChem CID | 107738170 |
| Molecular Formula | C12H14Br2O3 |
| Molecular Weight | 366.05 g/mol |
| Exact Mass | 363.93 |
| IUPAC Name | 3,5-dibromo-4-(3-hydroxy-3-methylbutoxy)benzaldehyde |
| SMILES | CC(C)(O)CCOc1c(Br)cc(C=O)cc1Br |
| InChI | InChI=1S/C12H14Br2O3/c1-12(2,16)3-4-17-11-9(13)5-8(7-15)6-10(11)14/h5-7,16H,3-4H2,1-2H3 |
| InChIKey | ZPJPWZNHTXMXBE-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.05 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|