C12H16Br2O3 — CID 107738999
4-[2,6-dibromo-4-(hydroxymethyl)phenoxy]-2-methylbutan-2-ol (PubChem CID 107738999) has the molecular formula C12H16Br2O3 and a molecular weight of 368.07 g/mol. Its IUPAC name is 4-[2,6-dibromo-4-(hydroxymethyl)phenoxy]-2-methylbutan-2-ol.
| Compound Name | 4-[2,6-dibromo-4-(hydroxymethyl)phenoxy]-2-methylbutan-2-ol |
|---|---|
| PubChem CID | 107738999 |
| Molecular Formula | C12H16Br2O3 |
| Molecular Weight | 368.07 g/mol |
| Exact Mass | 365.95 |
| IUPAC Name | 4-[2,6-dibromo-4-(hydroxymethyl)phenoxy]-2-methylbutan-2-ol |
| SMILES | CC(C)(O)CCOc1c(Br)cc(CO)cc1Br |
| InChI | InChI=1S/C12H16Br2O3/c1-12(2,16)3-4-17-11-9(13)5-8(7-15)6-10(11)14/h5-6,15-16H,3-4,7H2,1-2H3 |
| InChIKey | UQBZEHIECAVAQZ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.07 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |