C13H18Br2O2 — CID 107739092
[3,5-dibromo-4-(2-ethylbutoxy)phenyl]methanol (PubChem CID 107739092) has the molecular formula C13H18Br2O2 and a molecular weight of 366.09 g/mol. Its IUPAC name is [3,5-dibromo-4-(2-ethylbutoxy)phenyl]methanol.
| Compound Name | [3,5-dibromo-4-(2-ethylbutoxy)phenyl]methanol |
|---|---|
| PubChem CID | 107739092 |
| Molecular Formula | C13H18Br2O2 |
| Molecular Weight | 366.09 g/mol |
| Exact Mass | 363.97 |
| IUPAC Name | [3,5-dibromo-4-(2-ethylbutoxy)phenyl]methanol |
| SMILES | CCC(CC)COc1c(Br)cc(CO)cc1Br |
| InChI | InChI=1S/C13H18Br2O2/c1-3-9(4-2)8-17-13-11(14)5-10(7-16)6-12(13)15/h5-6,9,16H,3-4,7-8H2,1-2H3 |
| InChIKey | WPSUZOWPSYKXRR-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.09 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |