C11H13Br2ClO — CID 107745281
1,3-dibromo-5-(chloromethyl)-2-(2-methylpropoxy)benzene (PubChem CID 107745281) has the molecular formula C11H13Br2ClO and a molecular weight of 356.49 g/mol. Its IUPAC name is 1,3-dibromo-5-(chloromethyl)-2-(2-methylpropoxy)benzene.
| Compound Name | 1,3-dibromo-5-(chloromethyl)-2-(2-methylpropoxy)benzene |
|---|---|
| PubChem CID | 107745281 |
| Molecular Formula | C11H13Br2ClO |
| Molecular Weight | 356.49 g/mol |
| Exact Mass | 353.90 |
| IUPAC Name | 1,3-dibromo-5-(chloromethyl)-2-(2-methylpropoxy)benzene |
| SMILES | CC(C)COc1c(Br)cc(CCl)cc1Br |
| InChI | InChI=1S/C11H13Br2ClO/c1-7(2)6-15-11-9(12)3-8(5-14)4-10(11)13/h3-4,7H,5-6H2,1-2H3 |
| InChIKey | YSHGQESDUABBDC-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.49 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|