C13H17Br2ClO — CID 107745345
1,3-dibromo-5-(chloromethyl)-2-(3,3-dimethylbutoxy)benzene (PubChem CID 107745345) has the molecular formula C13H17Br2ClO and a molecular weight of 384.54 g/mol. Its IUPAC name is 1,3-dibromo-5-(chloromethyl)-2-(3,3-dimethylbutoxy)benzene.
| Compound Name | 1,3-dibromo-5-(chloromethyl)-2-(3,3-dimethylbutoxy)benzene |
|---|---|
| PubChem CID | 107745345 |
| Molecular Formula | C13H17Br2ClO |
| Molecular Weight | 384.54 g/mol |
| Exact Mass | 381.93 |
| IUPAC Name | 1,3-dibromo-5-(chloromethyl)-2-(3,3-dimethylbutoxy)benzene |
| SMILES | CC(C)(C)CCOc1c(Br)cc(CCl)cc1Br |
| InChI | InChI=1S/C13H17Br2ClO/c1-13(2,3)4-5-17-12-10(14)6-9(8-16)7-11(12)15/h6-7H,4-5,8H2,1-3H3 |
| InChIKey | OMEFGDCGKMJQJK-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.54 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|