C13H18ClFO — CID 112613586
1-(chloromethyl)-2-(3,3-dimethylbutoxy)-3-fluorobenzene (PubChem CID 112613586) has the molecular formula C13H18ClFO and a molecular weight of 244.74 g/mol. Its IUPAC name is 1-(chloromethyl)-2-(3,3-dimethylbutoxy)-3-fluorobenzene.
| Compound Name | 1-(chloromethyl)-2-(3,3-dimethylbutoxy)-3-fluorobenzene |
|---|---|
| PubChem CID | 112613586 |
| Molecular Formula | C13H18ClFO |
| Molecular Weight | 244.74 g/mol |
| Exact Mass | 244.10 |
| IUPAC Name | 1-(chloromethyl)-2-(3,3-dimethylbutoxy)-3-fluorobenzene |
| SMILES | CC(C)(C)CCOc1c(F)cccc1CCl |
| InChI | InChI=1S/C13H18ClFO/c1-13(2,3)7-8-16-12-10(9-14)5-4-6-11(12)15/h4-6H,7-9H2,1-3H3 |
| InChIKey | JYBDBGVXVUUEFP-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.74 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|