C13H15BrFNO — CID 112613920
4-[2-(bromomethyl)-6-fluorophenoxy]-2,2-dimethylbutanenitrile (PubChem CID 112613920) has the molecular formula C13H15BrFNO and a molecular weight of 300.17 g/mol. Its IUPAC name is 4-[2-(bromomethyl)-6-fluorophenoxy]-2,2-dimethylbutanenitrile.
| Compound Name | 4-[2-(bromomethyl)-6-fluorophenoxy]-2,2-dimethylbutanenitrile |
|---|---|
| PubChem CID | 112613920 |
| Molecular Formula | C13H15BrFNO |
| Molecular Weight | 300.17 g/mol |
| Exact Mass | 299.03 |
| IUPAC Name | 4-[2-(bromomethyl)-6-fluorophenoxy]-2,2-dimethylbutanenitrile |
| SMILES | CC(C)(C#N)CCOc1c(F)cccc1CBr |
| InChI | InChI=1S/C13H15BrFNO/c1-13(2,9-16)6-7-17-12-10(8-14)4-3-5-11(12)15/h3-5H,6-8H2,1-2H3 |
| InChIKey | LXKGUQJYPVRUQI-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.17 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|