C13H16BrNO — CID 65253458
4-[4-(bromomethyl)phenoxy]-2,2-dimethylbutanenitrile (PubChem CID 65253458) has the molecular formula C13H16BrNO and a molecular weight of 282.18 g/mol. Its IUPAC name is 4-[4-(bromomethyl)phenoxy]-2,2-dimethylbutanenitrile.
| Compound Name | 4-[4-(bromomethyl)phenoxy]-2,2-dimethylbutanenitrile |
|---|---|
| PubChem CID | 65253458 |
| Molecular Formula | C13H16BrNO |
| Molecular Weight | 282.18 g/mol |
| Exact Mass | 281.04 |
| IUPAC Name | 4-[4-(bromomethyl)phenoxy]-2,2-dimethylbutanenitrile |
| SMILES | CC(C)(C#N)CCOc1ccc(CBr)cc1 |
| InChI | InChI=1S/C13H16BrNO/c1-13(2,10-15)7-8-16-12-5-3-11(9-14)4-6-12/h3-6H,7-9H2,1-2H3 |
| InChIKey | QPHNFCPQJHEHSS-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.18 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|