C16H24N2O — CID 65250110
2,2-dimethyl-4-[4-(propylaminomethyl)phenoxy]butanenitrile (PubChem CID 65250110) has the molecular formula C16H24N2O and a molecular weight of 260.38 g/mol. Its IUPAC name is 2,2-dimethyl-4-[4-(propylaminomethyl)phenoxy]butanenitrile.
| Compound Name | 2,2-dimethyl-4-[4-(propylaminomethyl)phenoxy]butanenitrile |
|---|---|
| PubChem CID | 65250110 |
| Molecular Formula | C16H24N2O |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.19 |
| IUPAC Name | 2,2-dimethyl-4-[4-(propylaminomethyl)phenoxy]butanenitrile |
| SMILES | CCCNCc1ccc(OCCC(C)(C)C#N)cc1 |
| InChI | InChI=1S/C16H24N2O/c1-4-10-18-12-14-5-7-15(8-6-14)19-11-9-16(2,3)13-17/h5-8,18H,4,9-12H2,1-3H3 |
| InChIKey | KCVUOJAAWFLOIL-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|