C17H25FN2O — CID 115953409
5-[2-fluoro-6-(propylaminomethyl)phenoxy]-2,2-dimethylpentanenitrile (PubChem CID 115953409) has the molecular formula C17H25FN2O and a molecular weight of 292.40 g/mol. Its IUPAC name is 5-[2-fluoro-6-(propylaminomethyl)phenoxy]-2,2-dimethylpentanenitrile.
| Compound Name | 5-[2-fluoro-6-(propylaminomethyl)phenoxy]-2,2-dimethylpentanenitrile |
|---|---|
| PubChem CID | 115953409 |
| Molecular Formula | C17H25FN2O |
| Molecular Weight | 292.40 g/mol |
| Exact Mass | 292.20 |
| IUPAC Name | 5-[2-fluoro-6-(propylaminomethyl)phenoxy]-2,2-dimethylpentanenitrile |
| SMILES | CCCNCc1cccc(F)c1OCCCC(C)(C)C#N |
| InChI | InChI=1S/C17H25FN2O/c1-4-10-20-12-14-7-5-8-15(18)16(14)21-11-6-9-17(2,3)13-19/h5,7-8,20H,4,6,9-12H2,1-3H3 |
| InChIKey | OMKMDGAPWMAZMF-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.40 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|