C14H22FNO3S — CID 115953412
N-[[3-fluoro-2-(3-methylsulfonylpropoxy)phenyl]methyl]propan-1-amine (PubChem CID 115953412) has the molecular formula C14H22FNO3S and a molecular weight of 303.40 g/mol. Its IUPAC name is N-[[3-fluoro-2-(3-methylsulfonylpropoxy)phenyl]methyl]propan-1-amine.
| Compound Name | N-[[3-fluoro-2-(3-methylsulfonylpropoxy)phenyl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 115953412 |
| Molecular Formula | C14H22FNO3S |
| Molecular Weight | 303.40 g/mol |
| Exact Mass | 303.13 |
| IUPAC Name | N-[[3-fluoro-2-(3-methylsulfonylpropoxy)phenyl]methyl]propan-1-amine |
| SMILES | CCCNCc1cccc(F)c1OCCCS(C)(=O)=O |
| InChI | InChI=1S/C14H22FNO3S/c1-3-8-16-11-12-6-4-7-13(15)14(12)19-9-5-10-20(2,17)18/h4,6-7,16H,3,5,8-11H2,1-2H3 |
| InChIKey | YSEXVNNOUDIPEI-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.40 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|